Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Di(propylene glycol) methyl ether, 99%, pure, mixture of isomers
CAS: 34590-94-8 Molecular Formula: C7H16O3 Molecular Weight (g/mol): 148.2 MDL Number: MFCD00059604
| CAS | 34590-94-8 |
|---|---|
| Molecular Weight (g/mol) | 148.2 |
| MDL Number | MFCD00059604 |
| Molecular Formula | C7H16O3 |
1-Octene, 99+%
CAS: 111-66-0 Molecular Formula: C8H16 Molecular Weight (g/mol): 112.21 MDL Number: MFCD00009548 InChI Key: KWKAKUADMBZCLK-UHFFFAOYSA-N Synonym: 1-octene,caprylene,n-1-octene,1-octylene,octylene,alpha-octene,octene-1,1-caprylene,octene,alpha-octylene PubChem CID: 8125 ChEBI: CHEBI:46708 IUPAC Name: oct-1-ene SMILES: CCCCCCC=C
| PubChem CID | 8125 |
|---|---|
| CAS | 111-66-0 |
| Molecular Weight (g/mol) | 112.21 |
| ChEBI | CHEBI:46708 |
| MDL Number | MFCD00009548 |
| SMILES | CCCCCCC=C |
| Synonym | 1-octene,caprylene,n-1-octene,1-octylene,octylene,alpha-octene,octene-1,1-caprylene,octene,alpha-octylene |
| IUPAC Name | oct-1-ene |
| InChI Key | KWKAKUADMBZCLK-UHFFFAOYSA-N |
| Molecular Formula | C8H16 |
4-Vinyl-1-cyclohexene, 97%, stabilized
CAS: 100-40-3 Molecular Formula: C8H12 Molecular Weight (g/mol): 108.18 MDL Number: MFCD00001576 InChI Key: BBDKZWKEPDTENS-UHFFFAOYSA-N Synonym: 4-vinylcyclohexene,4-vinyl-1-cyclohexene,cyclohexene, 4-ethenyl,butadiene dimer,4-vinylcyclohex-1-ene,4-vinylcyclohexene-1,cyclohexene, 4-vinyl,cyclohexenylethylene,4-ethenyl-1-cyclohexene,1-vinylcyclohexene-3 PubChem CID: 7499 ChEBI: CHEBI:82377 IUPAC Name: 4-ethenylcyclohexene SMILES: C=CC1CCC=CC1
| PubChem CID | 7499 |
|---|---|
| CAS | 100-40-3 |
| Molecular Weight (g/mol) | 108.18 |
| ChEBI | CHEBI:82377 |
| MDL Number | MFCD00001576 |
| SMILES | C=CC1CCC=CC1 |
| Synonym | 4-vinylcyclohexene,4-vinyl-1-cyclohexene,cyclohexene, 4-ethenyl,butadiene dimer,4-vinylcyclohex-1-ene,4-vinylcyclohexene-1,cyclohexene, 4-vinyl,cyclohexenylethylene,4-ethenyl-1-cyclohexene,1-vinylcyclohexene-3 |
| IUPAC Name | 4-ethenylcyclohexene |
| InChI Key | BBDKZWKEPDTENS-UHFFFAOYSA-N |
| Molecular Formula | C8H12 |
Methylcyclohexane, 99%
CAS: 108-87-2 Molecular Formula: C7H14 Molecular Weight (g/mol): 98.19 MDL Number: MFCD00001497 InChI Key: UAEPNZWRGJTJPN-UHFFFAOYSA-N Synonym: cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan PubChem CID: 7962 IUPAC Name: methylcyclohexane SMILES: CC1CCCCC1
| PubChem CID | 7962 |
|---|---|
| CAS | 108-87-2 |
| Molecular Weight (g/mol) | 98.19 |
| MDL Number | MFCD00001497 |
| SMILES | CC1CCCCC1 |
| Synonym | cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan |
| IUPAC Name | methylcyclohexane |
| InChI Key | UAEPNZWRGJTJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H14 |
Calcium D-gluconate gel, 2.5% w/w aq. soln.
CAS: 299-28-5 Molecular Formula: C12H22CaO14 Molecular Weight (g/mol): 430.372 MDL Number: MFCD00064209 InChI Key: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC Name: calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
| PubChem CID | 9290 |
|---|---|
| CAS | 299-28-5 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CaO14 |
L-(+)-Ascorbic acid, 98+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Phenethyl alcohol, 99%
CAS: 60-12-8 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002886 InChI Key: WRMNZCZEMHIOCP-UHFFFAOYSA-N Synonym: phenethyl alcohol,benzeneethanol,phenylethyl alcohol,benzyl carbinol,phenylethanol,phenethanol,2-phenylethyl alcohol,2-phenyl-ethanol,beta-phenylethanol,2-phenylethan-1-ol PubChem CID: 6054 ChEBI: CHEBI:49000 SMILES: OCCC1=CC=CC=C1
| PubChem CID | 6054 |
|---|---|
| CAS | 60-12-8 |
| Molecular Weight (g/mol) | 122.17 |
| ChEBI | CHEBI:49000 |
| MDL Number | MFCD00002886 |
| SMILES | OCCC1=CC=CC=C1 |
| Synonym | phenethyl alcohol,benzeneethanol,phenylethyl alcohol,benzyl carbinol,phenylethanol,phenethanol,2-phenylethyl alcohol,2-phenyl-ethanol,beta-phenylethanol,2-phenylethan-1-ol |
| InChI Key | WRMNZCZEMHIOCP-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
Carbonyl cyanide 3-chlorophenylhydrazone, 98%
CAS: 555-60-2 Molecular Formula: C9H5ClN4 Molecular Weight (g/mol): 204.617 MDL Number: MFCD00001848 InChI Key: UGTJLJZQQFGTJD-UHFFFAOYSA-N Synonym: cccp,3-chlorophenyl hydrazonomalononitrile,carbonylcyanide-3-chlorophenylhydrazone,carbonyl cyanide 3-chlorophenylhydrazone,carbonyl cyanide m-chlorophenyl hydrazone,carbonyl cyanide m-chlorophenylhydrazone,3-chlorophenyl hydrazono malononitrile,m-chlorophenyl carbonylcyanide hydrazone,m-cl-ccp,carbonyl cyanide, 3-chlorophenyl hydrazone PubChem CID: 2603 ChEBI: CHEBI:3259 IUPAC Name: 2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile SMILES: C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N
| PubChem CID | 2603 |
|---|---|
| CAS | 555-60-2 |
| Molecular Weight (g/mol) | 204.617 |
| ChEBI | CHEBI:3259 |
| MDL Number | MFCD00001848 |
| SMILES | C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N |
| Synonym | cccp,3-chlorophenyl hydrazonomalononitrile,carbonylcyanide-3-chlorophenylhydrazone,carbonyl cyanide 3-chlorophenylhydrazone,carbonyl cyanide m-chlorophenyl hydrazone,carbonyl cyanide m-chlorophenylhydrazone,3-chlorophenyl hydrazono malononitrile,m-chlorophenyl carbonylcyanide hydrazone,m-cl-ccp,carbonyl cyanide, 3-chlorophenyl hydrazone |
| IUPAC Name | 2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile |
| InChI Key | UGTJLJZQQFGTJD-UHFFFAOYSA-N |
| Molecular Formula | C9H5ClN4 |
Hydroquinone, 99.5%
CAS: 123-31-9 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00002339 InChI Key: QIGBRXMKCJKVMJ-UHFFFAOYSA-N Synonym: hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol PubChem CID: 785 ChEBI: CHEBI:17594 IUPAC Name: benzene-1,4-diol SMILES: C1=CC(=CC=C1O)O
| PubChem CID | 785 |
|---|---|
| CAS | 123-31-9 |
| Molecular Weight (g/mol) | 110.11 |
| ChEBI | CHEBI:17594 |
| MDL Number | MFCD00002339 |
| SMILES | C1=CC(=CC=C1O)O |
| Synonym | hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol |
| IUPAC Name | benzene-1,4-diol |
| InChI Key | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
Resveratrol 99.0+%, TCI America™
CAS: 501-36-0 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.247 MDL Number: MFCD00133799 InChI Key: LUKBXSAWLPMMSZ-OWOJBTEDSA-N Synonym: resveratrol,trans-resveratrol,3,4',5-trihydroxystilbene,3,5,4'-trihydroxystilbene,e-resveratrol,3,4',5-stilbenetriol,e-5-4-hydroxystyryl benzene-1,3-diol,resvida,3,4',5-trihydroxy-trans-stilbene,5-e-2-4-hydroxyphenyl ethenyl benzene-1,3-diol PubChem CID: 445154 ChEBI: CHEBI:45713 IUPAC Name: 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol SMILES: C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O
| PubChem CID | 445154 |
|---|---|
| CAS | 501-36-0 |
| Molecular Weight (g/mol) | 228.247 |
| ChEBI | CHEBI:45713 |
| MDL Number | MFCD00133799 |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Synonym | resveratrol,trans-resveratrol,3,4',5-trihydroxystilbene,3,5,4'-trihydroxystilbene,e-resveratrol,3,4',5-stilbenetriol,e-5-4-hydroxystyryl benzene-1,3-diol,resvida,3,4',5-trihydroxy-trans-stilbene,5-e-2-4-hydroxyphenyl ethenyl benzene-1,3-diol |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChI Key | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Molecular Formula | C14H12O3 |
Dimethylglyoxime, 99+%
CAS: 95-45-4 Molecular Formula: C4H8N2O2 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00002117 InChI Key: JGUQDUKBUKFFRO-GGWOSOGESA-N Synonym: biacetyl dioxime,dimethylglyoxime,diacetyldioxime,2,3-butanedione dioxime,diacetyl dioxime,2,3-diisonitrosobutane,biacetyl, dioxime,chugaev's reagent,nsc 9,unii-2971mft1ky PubChem CID: 5356010 SMILES: C\C(=N/O)\C(\C)=N\O
| PubChem CID | 5356010 |
|---|---|
| CAS | 95-45-4 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00002117 |
| SMILES | C\C(=N/O)\C(\C)=N\O |
| Synonym | biacetyl dioxime,dimethylglyoxime,diacetyldioxime,2,3-butanedione dioxime,diacetyl dioxime,2,3-diisonitrosobutane,biacetyl, dioxime,chugaev's reagent,nsc 9,unii-2971mft1ky |
| InChI Key | JGUQDUKBUKFFRO-GGWOSOGESA-N |
| Molecular Formula | C4H8N2O2 |
Sodium 1-Hexanesulfonate 98.0+%, TCI America™
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 IUPAC Name: sodium hexane-1-sulfonate SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| IUPAC Name | sodium hexane-1-sulfonate |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |
Iodoacetic acid, 97%
CAS: 64-69-7 Molecular Formula: C2H3IO2 Molecular Weight (g/mol): 185.95 MDL Number: MFCD00002685 InChI Key: JDNTWHVOXJZDSN-UHFFFAOYSA-N Synonym: iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova PubChem CID: 5240 ChEBI: CHEBI:74571 IUPAC Name: 2-iodoacetic acid SMILES: C(C(=O)O)I
| PubChem CID | 5240 |
|---|---|
| CAS | 64-69-7 |
| Molecular Weight (g/mol) | 185.95 |
| ChEBI | CHEBI:74571 |
| MDL Number | MFCD00002685 |
| SMILES | C(C(=O)O)I |
| Synonym | iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova |
| IUPAC Name | 2-iodoacetic acid |
| InChI Key | JDNTWHVOXJZDSN-UHFFFAOYSA-N |
| Molecular Formula | C2H3IO2 |
Thermo Scientific Chemicals Fluorescein diacetate, 97%, pure
CAS: 596-09-8 Molecular Formula: C24H16O7 Molecular Weight (g/mol): 416.39 MDL Number: MFCD00005062 InChI Key: CHADEQDQBURGHL-UHFFFAOYSA-N Synonym: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 IUPAC Name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
| PubChem CID | 65047 |
|---|---|
| CAS | 596-09-8 |
| Molecular Weight (g/mol) | 416.39 |
| MDL Number | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Synonym | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Molecular Formula | C24H16O7 |
2-Naphthol, 98%
CAS: 135-19-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004067 InChI Key: JWAZRIHNYRIHIV-UHFFFAOYSA-N Synonym: 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol PubChem CID: 8663 ChEBI: CHEBI:10432 IUPAC Name: naphthalen-2-ol SMILES: C1=CC=C2C=C(C=CC2=C1)O
| PubChem CID | 8663 |
|---|---|
| CAS | 135-19-3 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:10432 |
| MDL Number | MFCD00004067 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)O |
| Synonym | 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol |
| IUPAC Name | naphthalen-2-ol |
| InChI Key | JWAZRIHNYRIHIV-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |